C36H73NO7S — CID 159642695
1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;tetrabutylazanium (PubChem CID 159642695) has the molecular formula C36H73NO7S and a molecular weight of 664.05 g/mol. Its IUPAC name is 1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;tetrabutylazanium.
| Compound Name | 1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;tetrabutylazanium |
|---|---|
| PubChem CID | 159642695 |
| Molecular Formula | C36H73NO7S |
| Molecular Weight | 664.05 g/mol |
| Exact Mass | 663.51 |
| IUPAC Name | 1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;tetrabutylazanium |
| SMILES | CCCCC(CC)COC(=O)CC(C(=O)OCC(CC)CCCC)S(=O)(=O)[O-].CCCC[N+](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C20H38O7S.C16H36N/c1-5-9-11-16(7-3)14-26-19(21)13-18(28(23,24)25)20(22)27-15-17(8-4)12-10-6-2;1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4/h16-18H,5-15H2,1-4H3,(H,23,24,25);5-16H2,1-4H3/q;+1/p-1 |
| InChIKey | MQOCDCBQMLLXAA-UHFFFAOYSA-M |
| XLogP | 8.81 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.05 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|