C22H43NaO8S — CID 87686282
sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;ethanol (PubChem CID 87686282) has the molecular formula C22H43NaO8S and a molecular weight of 490.64 g/mol. Its IUPAC name is sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;ethanol.
| Compound Name | sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;ethanol |
|---|---|
| PubChem CID | 87686282 |
| Molecular Formula | C22H43NaO8S |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;ethanol |
| SMILES | CCCCC(CC)COC(=O)CC(C(=O)OCC(CC)CCCC)S(=O)(=O)[O-].CCO.[Na+] |
| InChI | InChI=1S/C20H38O7S.C2H6O.Na/c1-5-9-11-16(7-3)14-26-19(21)13-18(28(23,24)25)20(22)27-15-17(8-4)12-10-6-2;1-2-3;/h16-18H,5-15H2,1-4H3,(H,23,24,25);3H,2H2,1H3;/q;;+1/p-1 |
| InChIKey | YIAKPHWEUFOOLY-UHFFFAOYSA-M |
| XLogP | 0.81 |
| TPSA | 130.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|