C26H51NaO11S — CID 87918776
sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;2-[2-(2-hydroxyethoxy)ethoxy]ethanol (PubChem CID 87918776) has the molecular formula C26H51NaO11S and a molecular weight of 594.74 g/mol. Its IUPAC name is sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;2-[2-(2-hydroxyethoxy)ethoxy]ethanol.
| Compound Name | sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;2-[2-(2-hydroxyethoxy)ethoxy]ethanol |
|---|---|
| PubChem CID | 87918776 |
| Molecular Formula | C26H51NaO11S |
| Molecular Weight | 594.74 g/mol |
| Exact Mass | 594.30 |
| IUPAC Name | sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;2-[2-(2-hydroxyethoxy)ethoxy]ethanol |
| SMILES | CCCCC(CC)COC(=O)CC(C(=O)OCC(CC)CCCC)S(=O)(=O)[O-].OCCOCCOCCO.[Na+] |
| InChI | InChI=1S/C20H38O7S.C6H14O4.Na/c1-5-9-11-16(7-3)14-26-19(21)13-18(28(23,24)25)20(22)27-15-17(8-4)12-10-6-2;7-1-3-9-5-6-10-4-2-8;/h16-18H,5-15H2,1-4H3,(H,23,24,25);7-8H,1-6H2;/q;;+1/p-1 |
| InChIKey | VJZOUMWULSZCLQ-UHFFFAOYSA-M |
| XLogP | -0.18 |
| TPSA | 168.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.74 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|