C20H40NaO11PS — CID 23689383
sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;phosphoric acid (PubChem CID 23689383) has the molecular formula C20H40NaO11PS and a molecular weight of 542.56 g/mol. Its IUPAC name is sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;phosphoric acid.
| Compound Name | sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;phosphoric acid |
|---|---|
| PubChem CID | 23689383 |
| Molecular Formula | C20H40NaO11PS |
| Molecular Weight | 542.56 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;phosphoric acid |
| SMILES | CCCCC(CC)COC(=O)CC(C(=O)OCC(CC)CCCC)S(=O)(=O)[O-].O=P(O)(O)O.[Na+] |
| InChI | InChI=1S/C20H38O7S.Na.H3O4P/c1-5-9-11-16(7-3)14-26-19(21)13-18(28(23,24)25)20(22)27-15-17(8-4)12-10-6-2;;1-5(2,3)4/h16-18H,5-15H2,1-4H3,(H,23,24,25);;(H3,1,2,3,4)/q;+1;/p-1 |
| InChIKey | CUVPCSOBFBURTG-UHFFFAOYSA-M |
| XLogP | -0.12 |
| TPSA | 187.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.56 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|