C26H51NaO9S — CID 88715920
sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;1,1-diethoxyethane (PubChem CID 88715920) has the molecular formula C26H51NaO9S and a molecular weight of 562.74 g/mol. Its IUPAC name is sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;1,1-diethoxyethane.
| Compound Name | sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;1,1-diethoxyethane |
|---|---|
| PubChem CID | 88715920 |
| Molecular Formula | C26H51NaO9S |
| Molecular Weight | 562.74 g/mol |
| Exact Mass | 562.32 |
| IUPAC Name | sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;1,1-diethoxyethane |
| SMILES | CCCCC(CC)COC(=O)CC(C(=O)OCC(CC)CCCC)S(=O)(=O)[O-].CCOC(C)OCC.[Na+] |
| InChI | InChI=1S/C20H38O7S.C6H14O2.Na/c1-5-9-11-16(7-3)14-26-19(21)13-18(28(23,24)25)20(22)27-15-17(8-4)12-10-6-2;1-4-7-6(3)8-5-2;/h16-18H,5-15H2,1-4H3,(H,23,24,25);6H,4-5H2,1-3H3;/q;;+1/p-1 |
| InChIKey | MALVOTLYQJBWEO-UHFFFAOYSA-M |
| XLogP | 2.22 |
| TPSA | 128.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.74 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|