C25H49NaO7S — CID 155234916
sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;pentane (PubChem CID 155234916) has the molecular formula C25H49NaO7S and a molecular weight of 516.72 g/mol. Its IUPAC name is sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;pentane.
| Compound Name | sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;pentane |
|---|---|
| PubChem CID | 155234916 |
| Molecular Formula | C25H49NaO7S |
| Molecular Weight | 516.72 g/mol |
| Exact Mass | 516.31 |
| IUPAC Name | sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;pentane |
| SMILES | CCCCC.CCCCC(CC)COC(=O)CC(C(=O)OCC(CC)CCCC)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C20H38O7S.C5H12.Na/c1-5-9-11-16(7-3)14-26-19(21)13-18(28(23,24)25)20(22)27-15-17(8-4)12-10-6-2;1-3-5-4-2;/h16-18H,5-15H2,1-4H3,(H,23,24,25);3-5H2,1-2H3;/q;;+1/p-1 |
| InChIKey | MBNAAPZRIPUKQL-UHFFFAOYSA-M |
| XLogP | 3.01 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.72 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|