C24H44NNaO8S — CID 88815808
sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;2-methylprop-2-enamide (PubChem CID 88815808) has the molecular formula C24H44NNaO8S and a molecular weight of 529.67 g/mol. Its IUPAC name is sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;2-methylprop-2-enamide.
| Compound Name | sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;2-methylprop-2-enamide |
|---|---|
| PubChem CID | 88815808 |
| Molecular Formula | C24H44NNaO8S |
| Molecular Weight | 529.67 g/mol |
| Exact Mass | 529.27 |
| IUPAC Name | sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;2-methylprop-2-enamide |
| SMILES | C=C(C)C(N)=O.CCCCC(CC)COC(=O)CC(C(=O)OCC(CC)CCCC)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C20H38O7S.C4H7NO.Na/c1-5-9-11-16(7-3)14-26-19(21)13-18(28(23,24)25)20(22)27-15-17(8-4)12-10-6-2;1-3(2)4(5)6;/h16-18H,5-15H2,1-4H3,(H,23,24,25);1H2,2H3,(H2,5,6);/q;;+1/p-1 |
| InChIKey | QDFUKDZTDMPZLB-UHFFFAOYSA-M |
| XLogP | 0.86 |
| TPSA | 152.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.67 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|