C21H42NNaO7S — CID 87390013
Sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;methanamine (PubChem CID 87390013) has the molecular formula C21H42NNaO7S and a molecular weight of 475.60 g/mol. Its IUPAC name is sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;methanamine.
| Compound Name | Sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;methanamine |
|---|---|
| PubChem CID | 87390013 |
| Molecular Formula | C21H42NNaO7S |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;methanamine |
| SMILES | CCCCC(CC)COC(=O)CC(C(=O)OCC(CC)CCCC)S(=O)(=O)[O-].CN.[Na+] |
| InChI | InChI=1S/C20H38O7S.CH5N.Na/c1-5-9-11-16(7-3)14-26-19(21)13-18(28(23,24)25)20(22)27-15-17(8-4)12-10-6-2;1-2;/h16-18H,5-15H2,1-4H3,(H,23,24,25);2H2,1H3;/q;;+1/p-1 |
| InChIKey | NRMIWMCNYYMNDV-UHFFFAOYSA-M |
| XLogP | — |
| TPSA | 144.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | 548 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|