C41H81NaO7S — CID 89439303
sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;2,3-dimethylnonadecane (PubChem CID 89439303) has the molecular formula C41H81NaO7S and a molecular weight of 741.15 g/mol. Its IUPAC name is sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;2,3-dimethylnonadecane.
| Compound Name | sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;2,3-dimethylnonadecane |
|---|---|
| PubChem CID | 89439303 |
| Molecular Formula | C41H81NaO7S |
| Molecular Weight | 741.15 g/mol |
| Exact Mass | 740.56 |
| IUPAC Name | sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate;2,3-dimethylnonadecane |
| SMILES | CCCCC(CC)COC(=O)CC(C(=O)OCC(CC)CCCC)S(=O)(=O)[O-].CCCCCCCCCCCCCCCCC(C)C(C)C.[Na+] |
| InChI | InChI=1S/C21H44.C20H38O7S.Na/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(4)20(2)3;1-5-9-11-16(7-3)14-26-19(21)13-18(28(23,24)25)20(22)27-15-17(8-4)12-10-6-2;/h20-21H,5-19H2,1-4H3;16-18H,5-15H2,1-4H3,(H,23,24,25);/q;;+1/p-1 |
| InChIKey | PFEBNKCRFBCQLS-UHFFFAOYSA-M |
| XLogP | 8.96 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.15 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|