C28H60N2O11S — CID 158315272
2-aminoethanol;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonic acid;2-[bis(2-hydroxyethyl)amino]ethanol (PubChem CID 158315272) has the molecular formula C28H60N2O11S and a molecular weight of 632.86 g/mol. Its IUPAC name is 2-aminoethanol;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonic acid;2-[bis(2-hydroxyethyl)amino]ethanol.
| Compound Name | 2-aminoethanol;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonic acid;2-[bis(2-hydroxyethyl)amino]ethanol |
|---|---|
| PubChem CID | 158315272 |
| Molecular Formula | C28H60N2O11S |
| Molecular Weight | 632.86 g/mol |
| Exact Mass | 632.39 |
| IUPAC Name | 2-aminoethanol;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonic acid;2-[bis(2-hydroxyethyl)amino]ethanol |
| SMILES | CCCCC(CC)COC(=O)CC(C(=O)OCC(CC)CCCC)S(=O)(=O)O.NCCO.OCCN(CCO)CCO |
| InChI | InChI=1S/C20H38O7S.C6H15NO3.C2H7NO/c1-5-9-11-16(7-3)14-26-19(21)13-18(28(23,24)25)20(22)27-15-17(8-4)12-10-6-2;8-4-1-7(2-5-9)3-6-10;3-1-2-4/h16-18H,5-15H2,1-4H3,(H,23,24,25);8-10H,1-6H2;4H,1-3H2 |
| InChIKey | GOEMXAIZPAIKOE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 217.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.86 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|