C27H28F26NO4S+ — CID 20768663
2-[1,4-dioxo-1,4-bis(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononoxy)butan-2-yl]sulfanylethyl-trimethylazanium (PubChem CID 20768663) has the molecular formula C27H28F26NO4S+ and a molecular weight of 956.54 g/mol. Its IUPAC name is 2-[1,4-dioxo-1,4-bis(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononoxy)butan-2-yl]sulfanylethyl-trimethylazanium.
| Compound Name | 2-[1,4-dioxo-1,4-bis(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononoxy)butan-2-yl]sulfanylethyl-trimethylazanium |
|---|---|
| PubChem CID | 20768663 |
| Molecular Formula | C27H28F26NO4S+ |
| Molecular Weight | 956.54 g/mol |
| Exact Mass | 956.13 |
| IUPAC Name | 2-[1,4-dioxo-1,4-bis(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononoxy)butan-2-yl]sulfanylethyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCSC(CC(=O)OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C27H28F26NO4S/c1-54(2,3)8-11-59-13(15(56)58-10-5-7-17(30,31)19(34,35)21(38,39)23(42,43)25(46,47)27(51,52)53)12-14(55)57-9-4-6-16(28,29)18(32,33)20(36,37)22(40,41)24(44,45)26(48,49)50/h13H,4-12H2,1-3H3/q+1 |
| InChIKey | OTLSUDOTMGCUPE-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 956.54 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|