C13H11F13O3 — CID 21278208
4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl 3-oxobutanoate (PubChem CID 21278208) has the molecular formula C13H11F13O3 and a molecular weight of 462.20 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl 3-oxobutanoate.
| Compound Name | 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl 3-oxobutanoate |
|---|---|
| PubChem CID | 21278208 |
| Molecular Formula | C13H11F13O3 |
| Molecular Weight | 462.20 g/mol |
| Exact Mass | 462.05 |
| IUPAC Name | 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl 3-oxobutanoate |
| SMILES | CC(=O)CC(=O)OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H11F13O3/c1-6(27)5-7(28)29-4-2-3-8(14,15)9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)26/h2-5H2,1H3 |
| InChIKey | FYTRDPUIGFJMJA-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.20 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|