C25H31F12NO7S2 — CID 91400524
2-[1-(3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorooctoxy)-4-methoxy-1,4-dioxobutan-2-yl]sulfanylethyl-trimethylazanium;4-methylbenzenesulfonate (PubChem CID 91400524) has the molecular formula C25H31F12NO7S2 and a molecular weight of 749.63 g/mol. Its IUPAC name is 2-[1-(3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorooctoxy)-4-methoxy-1,4-dioxobutan-2-yl]sulfanylethyl-trimethylazanium;4-methylbenzenesulfonate.
| Compound Name | 2-[1-(3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorooctoxy)-4-methoxy-1,4-dioxobutan-2-yl]sulfanylethyl-trimethylazanium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 91400524 |
| Molecular Formula | C25H31F12NO7S2 |
| Molecular Weight | 749.63 g/mol |
| Exact Mass | 749.14 |
| IUPAC Name | 2-[1-(3,3,4,4,5,5,6,6,7,7,8,8-dodecafluorooctoxy)-4-methoxy-1,4-dioxobutan-2-yl]sulfanylethyl-trimethylazanium;4-methylbenzenesulfonate |
| SMILES | COC(=O)CC(SCC[N+](C)(C)C)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C18H24F12NO4S.C7H8O3S/c1-31(2,3)6-8-36-10(9-11(32)34-4)12(33)35-7-5-14(21,22)16(25,26)18(29,30)17(27,28)15(23,24)13(19)20;1-6-2-4-7(5-3-6)11(8,9)10/h10,13H,5-9H2,1-4H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | DSAKNIVTGWZXGL-UHFFFAOYSA-M |
| XLogP | 5.63 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.63 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|