About bis(3-methylbutyl) 2-(benzenecarbonothioylsulfanyl)butanedioate
bis(3-methylbutyl) 2-(benzenecarbonothioylsulfanyl)butanedioate (PubChem CID 58846464) has the molecular formula C21H30O4S2
and a molecular weight of 410.60 g/mol. Its IUPAC name is bis(3-methylbutyl) 2-(benzenecarbonothioylsulfanyl)butanedioate.
Molecular Properties
| Compound Name | bis(3-methylbutyl) 2-(benzenecarbonothioylsulfanyl)butanedioate |
| PubChem CID | 58846464 |
| Molecular Formula | C21H30O4S2 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | bis(3-methylbutyl) 2-(benzenecarbonothioylsulfanyl)butanedioate |
| SMILES | CC(C)CCOC(=O)CC(SC(=S)c1ccccc1)C(=O)OCCC(C)C |
| InChI | InChI=1S/C21H30O4S2/c1-15(2)10-12-24-19(22)14-18(20(23)25-13-11-16(3)4)27-21(26)17-8-6-5-7-9-17/h5-9,15-16,18H,10-14H2,1-4H3 |
| InChIKey | INFKAZWEUBZTCH-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ester_B(4)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze bis(3-methylbutyl) 2-(benzenecarbonothioylsulfanyl)butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-methylbutyl) 2-(benzenecarbonothioylsulfanyl)butanedioate?
The IUPAC name of bis(3-methylbutyl) 2-(benzenecarbonothioylsulfanyl)butanedioate (CID 58846464) is bis(3-methylbutyl) 2-(benzenecarbonothioylsulfanyl)butanedioate.
What is the SMILES notation for bis(3-methylbutyl) 2-(benzenecarbonothioylsulfanyl)butanedioate?
The canonical SMILES for bis(3-methylbutyl) 2-(benzenecarbonothioylsulfanyl)butanedioate is CC(C)CCOC(=O)CC(SC(=S)c1ccccc1)C(=O)OCCC(C)C.
What is the InChIKey of bis(3-methylbutyl) 2-(benzenecarbonothioylsulfanyl)butanedioate?
The InChIKey is INFKAZWEUBZTCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30O4S2/c1-15(2)10-12-24-19(22)14-18(20(23)25-13-11-16(3)4)27-21(26)17-8-6-5-7-9-17/h5-9,15-16,18H,10-14H2,1-4H3.
What are the key properties of bis(3-methylbutyl) 2-(benzenecarbonothioylsulfanyl)butanedioate?
bis(3-methylbutyl) 2-(benzenecarbonothioylsulfanyl)butanedioate has a molecular weight of 410.60 g/mol, XLogP of 5.03, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-methylbutyl) 2-(benzenecarbonothioylsulfanyl)butanedioate is sourced from PubChem (CID 58846464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).