C14H16F10O7S — CID 59488992
4-O-(3,4,4,5,5-pentafluoropentan-2-yl) 1-O-(3,4,4,5,5-pentafluoropentyl) 2-(trioxidanylsulfanyl)butanedioate (PubChem CID 59488992) has the molecular formula C14H16F10O7S and a molecular weight of 518.32 g/mol. Its IUPAC name is 4-O-(3,4,4,5,5-pentafluoropentan-2-yl) 1-O-(3,4,4,5,5-pentafluoropentyl) 2-(trioxidanylsulfanyl)butanedioate.
| Compound Name | 4-O-(3,4,4,5,5-pentafluoropentan-2-yl) 1-O-(3,4,4,5,5-pentafluoropentyl) 2-(trioxidanylsulfanyl)butanedioate |
|---|---|
| PubChem CID | 59488992 |
| Molecular Formula | C14H16F10O7S |
| Molecular Weight | 518.32 g/mol |
| Exact Mass | 518.05 |
| IUPAC Name | 4-O-(3,4,4,5,5-pentafluoropentan-2-yl) 1-O-(3,4,4,5,5-pentafluoropentyl) 2-(trioxidanylsulfanyl)butanedioate |
| SMILES | CC(OC(=O)CC(SOOO)C(=O)OCCC(F)C(F)(F)C(F)F)C(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C14H16F10O7S/c1-5(9(16)14(23,24)12(19)20)29-8(25)4-6(32-31-30-27)10(26)28-3-2-7(15)13(21,22)11(17)18/h5-7,9,11-12,27H,2-4H2,1H3 |
| InChIKey | HKHJMBONZDDFIZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.32 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|