C11H18O3 — CID 90441665
3-hexan-3-yl-4-methyloxolane-2,5-dione (PubChem CID 90441665) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is 3-hexan-3-yl-4-methyloxolane-2,5-dione.
| Compound Name | 3-hexan-3-yl-4-methyloxolane-2,5-dione |
|---|---|
| PubChem CID | 90441665 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 3-hexan-3-yl-4-methyloxolane-2,5-dione |
| SMILES | CCCC(CC)C1C(=O)OC(=O)C1C |
| InChI | InChI=1S/C11H18O3/c1-4-6-8(5-2)9-7(3)10(12)14-11(9)13/h7-9H,4-6H2,1-3H3 |
| InChIKey | XSZFITCKDILGPM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|