About 3,4-di(butan-2-yl)oxolane-2,5-dione
3,4-di(butan-2-yl)oxolane-2,5-dione (PubChem CID 126576326) has the molecular formula C12H20O3
and a molecular weight of 212.29 g/mol. Its IUPAC name is 3,4-di(butan-2-yl)oxolane-2,5-dione.
Molecular Properties
| Compound Name | 3,4-di(butan-2-yl)oxolane-2,5-dione |
| PubChem CID | 126576326 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 3,4-di(butan-2-yl)oxolane-2,5-dione |
| SMILES | CCC(C)C1C(=O)OC(=O)C1C(C)CC |
| InChI | InChI=1S/C12H20O3/c1-5-7(3)9-10(8(4)6-2)12(14)15-11(9)13/h7-10H,5-6H2,1-4H3 |
| InChIKey | NIYOYWLIMXMKAL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3,4-di(butan-2-yl)oxolane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-di(butan-2-yl)oxolane-2,5-dione?
The IUPAC name of 3,4-di(butan-2-yl)oxolane-2,5-dione (CID 126576326) is 3,4-di(butan-2-yl)oxolane-2,5-dione.
What is the SMILES notation for 3,4-di(butan-2-yl)oxolane-2,5-dione?
The canonical SMILES for 3,4-di(butan-2-yl)oxolane-2,5-dione is CCC(C)C1C(=O)OC(=O)C1C(C)CC.
What is the InChIKey of 3,4-di(butan-2-yl)oxolane-2,5-dione?
The InChIKey is NIYOYWLIMXMKAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O3/c1-5-7(3)9-10(8(4)6-2)12(14)15-11(9)13/h7-10H,5-6H2,1-4H3.
What are the key properties of 3,4-di(butan-2-yl)oxolane-2,5-dione?
3,4-di(butan-2-yl)oxolane-2,5-dione has a molecular weight of 212.29 g/mol, XLogP of 2.39, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-di(butan-2-yl)oxolane-2,5-dione is sourced from PubChem (CID 126576326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).