C11H20O3Si — CID 58918127
3-methyl-4-(1-trimethylsilylpropan-2-yl)oxolane-2,5-dione (PubChem CID 58918127) has the molecular formula C11H20O3Si and a molecular weight of 228.36 g/mol. Its IUPAC name is 3-methyl-4-(1-trimethylsilylpropan-2-yl)oxolane-2,5-dione.
| Compound Name | 3-methyl-4-(1-trimethylsilylpropan-2-yl)oxolane-2,5-dione |
|---|---|
| PubChem CID | 58918127 |
| Molecular Formula | C11H20O3Si |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 3-methyl-4-(1-trimethylsilylpropan-2-yl)oxolane-2,5-dione |
| SMILES | CC(C[Si](C)(C)C)C1C(=O)OC(=O)C1C |
| InChI | InChI=1S/C11H20O3Si/c1-7(6-15(3,4)5)9-8(2)10(12)14-11(9)13/h7-9H,6H2,1-5H3 |
| InChIKey | LDBQOPCHTKDQDE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|