C10H14O8 — CID 77215762
2,3,4-triacetyloxybutanoic acid (PubChem CID 77215762) has the molecular formula C10H14O8 and a molecular weight of 262.21 g/mol. Its IUPAC name is 2,3,4-triacetyloxybutanoic acid.
| Compound Name | 2,3,4-triacetyloxybutanoic acid |
|---|---|
| PubChem CID | 77215762 |
| Molecular Formula | C10H14O8 |
| Molecular Weight | 262.21 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 2,3,4-triacetyloxybutanoic acid |
| SMILES | CC(=O)OCC(OC(C)=O)C(OC(C)=O)C(=O)O |
| InChI | InChI=1S/C10H14O8/c1-5(11)16-4-8(17-6(2)12)9(10(14)15)18-7(3)13/h8-9H,4H2,1-3H3,(H,14,15) |
| InChIKey | QTCHQFITEKIBFI-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.21 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|