C36H53N3O22 — CID 101074456
[(2R,3R,4S,5R)-2,3,4,5-tetraacetyloxy-6-oxo-6-[2-[2-[[(2R,3S,4R,5R)-2,3,4,5,6-pentaacetyloxyhexanoyl]amino]ethylamino]ethylamino]hexyl] acetate (PubChem CID 101074456) has the molecular formula C36H53N3O22 and a molecular weight of 879.82 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-2,3,4,5-tetraacetyloxy-6-oxo-6-[2-[2-[[(2R,3S,4R,5R)-2,3,4,5,6-pentaacetyloxyhexanoyl]amino]ethylamino]ethylamino]hexyl] acetate.
| Compound Name | [(2R,3R,4S,5R)-2,3,4,5-tetraacetyloxy-6-oxo-6-[2-[2-[[(2R,3S,4R,5R)-2,3,4,5,6-pentaacetyloxyhexanoyl]amino]ethylamino]ethylamino]hexyl] acetate |
|---|---|
| PubChem CID | 101074456 |
| Molecular Formula | C36H53N3O22 |
| Molecular Weight | 879.82 g/mol |
| Exact Mass | 879.31 |
| IUPAC Name | [(2R,3R,4S,5R)-2,3,4,5-tetraacetyloxy-6-oxo-6-[2-[2-[[(2R,3S,4R,5R)-2,3,4,5,6-pentaacetyloxyhexanoyl]amino]ethylamino]ethylamino]hexyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)C(=O)NCCNCCNC(=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C36H53N3O22/c1-17(40)52-15-27(54-19(3)42)29(56-21(5)44)31(58-23(7)46)33(60-25(9)48)35(50)38-13-11-37-12-14-39-36(51)34(61-26(10)49)32(59-24(8)47)30(57-22(6)45)28(55-20(4)43)16-53-18(2)41/h27-34,37H,11-16H2,1-10H3,(H,38,50)(H,39,51)/t27-,28-,29-,30-,31+,32+,33-,34-/m1/s1 |
| InChIKey | UOGRDKCFCWYVTL-OLGIONGGSA-N |
| XLogP | -2.61 |
| TPSA | 333.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 23 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 879.82 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 23 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|