C20H31NO11 — CID 4529853
[2,3,4,5-tetraacetyloxy-6-(diethylamino)-6-oxohexyl] acetate (PubChem CID 4529853) has the molecular formula C20H31NO11 and a molecular weight of 461.46 g/mol. Its IUPAC name is [2,3,4,5-tetraacetyloxy-6-(diethylamino)-6-oxohexyl] acetate.
| Compound Name | [2,3,4,5-tetraacetyloxy-6-(diethylamino)-6-oxohexyl] acetate |
|---|---|
| PubChem CID | 4529853 |
| Molecular Formula | C20H31NO11 |
| Molecular Weight | 461.46 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | [2,3,4,5-tetraacetyloxy-6-(diethylamino)-6-oxohexyl] acetate |
| SMILES | CCN(CC)C(=O)C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C20H31NO11/c1-8-21(9-2)20(27)19(32-15(7)26)18(31-14(6)25)17(30-13(5)24)16(29-12(4)23)10-28-11(3)22/h16-19H,8-10H2,1-7H3 |
| InChIKey | LJGBYXWNVDAOAG-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 151.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.46 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|