C42H72N2O14 — CID 89060282
4,8,13,17-tetramethyl-20-oxo-20-[2-[[(2R,3S,4R)-2,3,4,5,6-pentaacetyloxyhexanoyl]amino]ethylamino]icosanoic acid (PubChem CID 89060282) has the molecular formula C42H72N2O14 and a molecular weight of 829.04 g/mol. Its IUPAC name is 4,8,13,17-tetramethyl-20-oxo-20-[2-[[(2R,3S,4R)-2,3,4,5,6-pentaacetyloxyhexanoyl]amino]ethylamino]icosanoic acid.
| Compound Name | 4,8,13,17-tetramethyl-20-oxo-20-[2-[[(2R,3S,4R)-2,3,4,5,6-pentaacetyloxyhexanoyl]amino]ethylamino]icosanoic acid |
|---|---|
| PubChem CID | 89060282 |
| Molecular Formula | C42H72N2O14 |
| Molecular Weight | 829.04 g/mol |
| Exact Mass | 828.50 |
| IUPAC Name | 4,8,13,17-tetramethyl-20-oxo-20-[2-[[(2R,3S,4R)-2,3,4,5,6-pentaacetyloxyhexanoyl]amino]ethylamino]icosanoic acid |
| SMILES | CC(=O)OCC(OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)C(=O)NCCNC(=O)CCC(C)CCCC(C)CCCCC(C)CCCC(C)CCC(=O)O |
| InChI | InChI=1S/C42H72N2O14/c1-27(14-10-11-15-28(2)17-13-19-30(4)21-23-38(51)52)16-12-18-29(3)20-22-37(50)43-24-25-44-42(53)41(58-35(9)49)40(57-34(8)48)39(56-33(7)47)36(55-32(6)46)26-54-31(5)45/h27-30,36,39-41H,10-26H2,1-9H3,(H,43,50)(H,44,53)(H,51,52)/t27?,28?,29?,30?,36?,39-,40+,41-/m1/s1 |
| InChIKey | WDISUIKIVLXNMM-GHYCTVAASA-N |
| XLogP | 5.60 |
| TPSA | 227.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.04 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|