C85H155B2N9O21 — CID 90908891
CID 90908891 (PubChem CID 90908891) has the molecular formula C85H155B2N9O21 and a molecular weight of 1660.84 g/mol.
| Compound Name | CID 90908891 |
|---|---|
| PubChem CID | 90908891 |
| Molecular Formula | C85H155B2N9O21 |
| Molecular Weight | 1660.84 g/mol |
| Exact Mass | 1660.15 |
| IUPAC Name | — |
| SMILES | [B]NCCCN(CCCCN(CC(CCCCCCNC(=O)CCC(C)CCCC(C)CCCCC(C)CCCC(C)CCC(=O)NCCNC(=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)CN(CCCCN(CCCN[B])C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C85H155B2N9O21/c1-61(36-25-26-37-62(2)39-33-41-64(4)44-46-73(103)89-50-51-90-77(104)76(113-69(9)101)75(112-68(8)100)74(111-67(7)99)71(110-66(6)98)60-109-65(5)97)38-32-40-63(3)43-45-72(102)88-47-27-23-22-24-42-70(58-95(80(107)116-84(16,17)18)54-30-28-52-93(56-34-48-91-86)78(105)114-82(10,11)12)59-96(81(108)117-85(19,20)21)55-31-29-53-94(57-35-49-92-87)79(106)115-83(13,14)15/h61-64,70-71,74-76,91-92H,22-60H2,1-21H3,(H,88,102)(H,89,103)(H,90,104)/t61?,62?,63?,64?,71-,74-,75+,76-/m1/s1 |
| InChIKey | XGEWONQTAJAJGC-BOAFKRQRSA-N |
| XLogP | 12.83 |
| TPSA | 361.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 23 |
| Rotatable Bonds | 61 |
| Heavy Atoms | 117 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1660.84 |
| LogP ≤ 5 | 12.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 23 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|