C22H33NO13 — CID 25227982
methyl (2S)-3-methyl-2-[[(2R,3S,4R,5R)-2,3,4,5,6-pentaacetyloxyhexanoyl]amino]butanoate (PubChem CID 25227982) has the molecular formula C22H33NO13 and a molecular weight of 519.50 g/mol. Its IUPAC name is methyl (2S)-3-methyl-2-[[(2R,3S,4R,5R)-2,3,4,5,6-pentaacetyloxyhexanoyl]amino]butanoate.
| Compound Name | methyl (2S)-3-methyl-2-[[(2R,3S,4R,5R)-2,3,4,5,6-pentaacetyloxyhexanoyl]amino]butanoate |
|---|---|
| PubChem CID | 25227982 |
| Molecular Formula | C22H33NO13 |
| Molecular Weight | 519.50 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | methyl (2S)-3-methyl-2-[[(2R,3S,4R,5R)-2,3,4,5,6-pentaacetyloxyhexanoyl]amino]butanoate |
| SMILES | COC(=O)[C@@H](NC(=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)C(C)C |
| InChI | InChI=1S/C22H33NO13/c1-10(2)17(22(30)31-8)23-21(29)20(36-15(7)28)19(35-14(6)27)18(34-13(5)26)16(33-12(4)25)9-32-11(3)24/h10,16-20H,9H2,1-8H3,(H,23,29)/t16-,17+,18-,19+,20-/m1/s1 |
| InChIKey | BVOCXDDWPHURAX-UJMXGEILSA-N |
| XLogP | -0.41 |
| TPSA | 186.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.50 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|