C26H38N2O16S2 — CID 25227985
methyl (2R)-2-acetamido-3-[[(2R)-3-methoxy-3-oxo-2-[[(2R,3S,4R,5R)-2,3,4,5,6-pentaacetyloxyhexanoyl]amino]propyl]disulfanyl]propanoate (PubChem CID 25227985) has the molecular formula C26H38N2O16S2 and a molecular weight of 698.72 g/mol. Its IUPAC name is methyl (2R)-2-acetamido-3-[[(2R)-3-methoxy-3-oxo-2-[[(2R,3S,4R,5R)-2,3,4,5,6-pentaacetyloxyhexanoyl]amino]propyl]disulfanyl]propanoate.
| Compound Name | methyl (2R)-2-acetamido-3-[[(2R)-3-methoxy-3-oxo-2-[[(2R,3S,4R,5R)-2,3,4,5,6-pentaacetyloxyhexanoyl]amino]propyl]disulfanyl]propanoate |
|---|---|
| PubChem CID | 25227985 |
| Molecular Formula | C26H38N2O16S2 |
| Molecular Weight | 698.72 g/mol |
| Exact Mass | 698.17 |
| IUPAC Name | methyl (2R)-2-acetamido-3-[[(2R)-3-methoxy-3-oxo-2-[[(2R,3S,4R,5R)-2,3,4,5,6-pentaacetyloxyhexanoyl]amino]propyl]disulfanyl]propanoate |
| SMILES | COC(=O)[C@H](CSSC[C@H](NC(=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)C(=O)OC)NC(C)=O |
| InChI | InChI=1S/C26H38N2O16S2/c1-12(29)27-18(25(36)38-7)10-45-46-11-19(26(37)39-8)28-24(35)23(44-17(6)34)22(43-16(5)33)21(42-15(4)32)20(41-14(3)31)9-40-13(2)30/h18-23H,9-11H2,1-8H3,(H,27,29)(H,28,35)/t18-,19-,20+,21+,22-,23+/m0/s1 |
| InChIKey | BTGRBNGGVMXVHT-FAQXLEIZSA-N |
| XLogP | -1.01 |
| TPSA | 242.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.72 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|