C20H26NO7- — CID 176598663
2-[1-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-4-methyl-2,5-dioxopyrrolidin-3-yl]-3-phenylpentanoate (PubChem CID 176598663) has the molecular formula C20H26NO7- and a molecular weight of 392.43 g/mol. Its IUPAC name is 2-[1-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-4-methyl-2,5-dioxopyrrolidin-3-yl]-3-phenylpentanoate.
| Compound Name | 2-[1-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-4-methyl-2,5-dioxopyrrolidin-3-yl]-3-phenylpentanoate |
|---|---|
| PubChem CID | 176598663 |
| Molecular Formula | C20H26NO7- |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 2-[1-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-4-methyl-2,5-dioxopyrrolidin-3-yl]-3-phenylpentanoate |
| SMILES | CCC(c1ccccc1)C(C(=O)[O-])C1C(=O)N(C(CO)(CO)CO)C(=O)C1C |
| InChI | InChI=1S/C20H27NO7/c1-3-14(13-7-5-4-6-8-13)16(19(27)28)15-12(2)17(25)21(18(15)26)20(9-22,10-23)11-24/h4-8,12,14-16,22-24H,3,9-11H2,1-2H3,(H,27,28)/p-1 |
| InChIKey | TYVLHZDGYVXZFZ-UHFFFAOYSA-M |
| XLogP | -1.12 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|