C15H16F3NO5S — CID 22986479
[3-methyl-2,5-dioxo-4-(1-phenylpropyl)pyrrolidin-1-yl] trifluoromethanesulfonate (PubChem CID 22986479) has the molecular formula C15H16F3NO5S and a molecular weight of 379.36 g/mol. Its IUPAC name is [3-methyl-2,5-dioxo-4-(1-phenylpropyl)pyrrolidin-1-yl] trifluoromethanesulfonate.
| Compound Name | [3-methyl-2,5-dioxo-4-(1-phenylpropyl)pyrrolidin-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 22986479 |
| Molecular Formula | C15H16F3NO5S |
| Molecular Weight | 379.36 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | [3-methyl-2,5-dioxo-4-(1-phenylpropyl)pyrrolidin-1-yl] trifluoromethanesulfonate |
| SMILES | CCC(c1ccccc1)C1C(=O)N(OS(=O)(=O)C(F)(F)F)C(=O)C1C |
| InChI | InChI=1S/C15H16F3NO5S/c1-3-11(10-7-5-4-6-8-10)12-9(2)13(20)19(14(12)21)24-25(22,23)15(16,17)18/h4-9,11-12H,3H2,1-2H3 |
| InChIKey | WAGKZWAUXHADAV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|