C12H15F3O2S — CID 155261822
(1-butan-2-ylsulfonyl-2,2,2-trifluoroethyl)benzene (PubChem CID 155261822) has the molecular formula C12H15F3O2S and a molecular weight of 280.31 g/mol. Its IUPAC name is (1-butan-2-ylsulfonyl-2,2,2-trifluoroethyl)benzene.
| Compound Name | (1-butan-2-ylsulfonyl-2,2,2-trifluoroethyl)benzene |
|---|---|
| PubChem CID | 155261822 |
| Molecular Formula | C12H15F3O2S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | (1-butan-2-ylsulfonyl-2,2,2-trifluoroethyl)benzene |
| SMILES | CCC(C)S(=O)(=O)C(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C12H15F3O2S/c1-3-9(2)18(16,17)11(12(13,14)15)10-7-5-4-6-8-10/h4-9,11H,3H2,1-2H3 |
| InChIKey | SDWOWBUFWOJRRM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |