C12H16F3NO — CID 68863509
4-amino-6,6,6-trifluoro-5-phenylhexan-3-ol (PubChem CID 68863509) has the molecular formula C12H16F3NO and a molecular weight of 247.26 g/mol. Its IUPAC name is 4-amino-6,6,6-trifluoro-5-phenylhexan-3-ol.
| Compound Name | 4-amino-6,6,6-trifluoro-5-phenylhexan-3-ol |
|---|---|
| PubChem CID | 68863509 |
| Molecular Formula | C12H16F3NO |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 4-amino-6,6,6-trifluoro-5-phenylhexan-3-ol |
| SMILES | CCC(O)C(N)C(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C12H16F3NO/c1-2-9(17)11(16)10(12(13,14)15)8-6-4-3-5-7-8/h3-7,9-11,17H,2,16H2,1H3 |
| InChIKey | NNWPYWKGMXPFJY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |