C23H32N2O3 — CID 66832312
[(2S,4S,5S)-5-amino-4-hydroxy-7,7-dimethyl-1,6-diphenyloctan-2-yl]carbamic acid (PubChem CID 66832312) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is [(2S,4S,5S)-5-amino-4-hydroxy-7,7-dimethyl-1,6-diphenyloctan-2-yl]carbamic acid.
| Compound Name | [(2S,4S,5S)-5-amino-4-hydroxy-7,7-dimethyl-1,6-diphenyloctan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 66832312 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | [(2S,4S,5S)-5-amino-4-hydroxy-7,7-dimethyl-1,6-diphenyloctan-2-yl]carbamic acid |
| SMILES | CC(C)(C)C(c1ccccc1)[C@H](N)[C@@H](O)C[C@H](Cc1ccccc1)NC(=O)O |
| InChI | InChI=1S/C23H32N2O3/c1-23(2,3)20(17-12-8-5-9-13-17)21(24)19(26)15-18(25-22(27)28)14-16-10-6-4-7-11-16/h4-13,18-21,25-26H,14-15,24H2,1-3H3,(H,27,28)/t18-,19-,20?,21+/m0/s1 |
| InChIKey | CKQZYCROKBXLJS-WINMLXNCSA-N |
| XLogP | 3.77 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |