C21H27B2NO2 — CID 91289289
CID 91289289 (PubChem CID 91289289) has the molecular formula C21H27B2NO2 and a molecular weight of 347.08 g/mol.
| Compound Name | CID 91289289 |
|---|---|
| PubChem CID | 91289289 |
| Molecular Formula | C21H27B2NO2 |
| Molecular Weight | 347.08 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | — |
| SMILES | [B]C.[B]C(=O)N[C@@H](Cc1ccccc1)C[C@H](O)[C@@H](C)Cc1ccccc1 |
| InChI | InChI=1S/C20H24BNO2.CH3B/c1-15(12-16-8-4-2-5-9-16)19(23)14-18(22-20(21)24)13-17-10-6-3-7-11-17;1-2/h2-11,15,18-19,23H,12-14H2,1H3,(H,22,24);1H3/t15-,18-,19-;/m0./s1 |
| InChIKey | DYVNZKXZKFBMAZ-HIKKPYDISA-N |
| XLogP | 3.31 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.08 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|