C33H48N4O5 — CID 25096867
(2S,3R)-2-acetamido-N-[(2S,4S,5S)-5-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-3-methylpentanamide (PubChem CID 25096867) has the molecular formula C33H48N4O5 and a molecular weight of 580.77 g/mol. Its IUPAC name is (2S,3R)-2-acetamido-N-[(2S,4S,5S)-5-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-3-methylpentanamide.
| Compound Name | (2S,3R)-2-acetamido-N-[(2S,4S,5S)-5-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-3-methylpentanamide |
|---|---|
| PubChem CID | 25096867 |
| Molecular Formula | C33H48N4O5 |
| Molecular Weight | 580.77 g/mol |
| Exact Mass | 580.36 |
| IUPAC Name | (2S,3R)-2-acetamido-N-[(2S,4S,5S)-5-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-4-hydroxy-1,6-diphenylhexan-2-yl]-3-methylpentanamide |
| SMILES | CC[C@@H](C)[C@H](NC(C)=O)C(=O)N[C@@H](Cc1ccccc1)C[C@H](O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(C)=O)C(C)C |
| InChI | InChI=1S/C33H48N4O5/c1-7-22(4)31(35-24(6)39)33(42)36-27(18-25-14-10-8-11-15-25)20-29(40)28(19-26-16-12-9-13-17-26)37-32(41)30(21(2)3)34-23(5)38/h8-17,21-22,27-31,40H,7,18-20H2,1-6H3,(H,34,38)(H,35,39)(H,36,42)(H,37,41)/t22-,27+,28+,29+,30+,31+/m1/s1 |
| InChIKey | VQAREBKWHMKTSI-YWZWRZHGSA-N |
| XLogP | 2.90 |
| TPSA | 136.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.77 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |