C32H52N4O5 — CID 15948846
(2S,3S)-2-acetamido-N-[(1R,3S,4S)-4-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-1-cyclohexyl-3-hydroxy-5-phenylpentyl]-3-methylpentanamide (PubChem CID 15948846) has the molecular formula C32H52N4O5 and a molecular weight of 572.79 g/mol. Its IUPAC name is (2S,3S)-2-acetamido-N-[(1R,3S,4S)-4-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-1-cyclohexyl-3-hydroxy-5-phenylpentyl]-3-methylpentanamide.
| Compound Name | (2S,3S)-2-acetamido-N-[(1R,3S,4S)-4-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-1-cyclohexyl-3-hydroxy-5-phenylpentyl]-3-methylpentanamide |
|---|---|
| PubChem CID | 15948846 |
| Molecular Formula | C32H52N4O5 |
| Molecular Weight | 572.79 g/mol |
| Exact Mass | 572.39 |
| IUPAC Name | (2S,3S)-2-acetamido-N-[(1R,3S,4S)-4-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-1-cyclohexyl-3-hydroxy-5-phenylpentyl]-3-methylpentanamide |
| SMILES | CC[C@H](C)[C@H](NC(C)=O)C(=O)N[C@H](C[C@H](O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(C)=O)C(C)C)C1CCCCC1 |
| InChI | InChI=1S/C32H52N4O5/c1-7-21(4)30(34-23(6)38)32(41)35-26(25-16-12-9-13-17-25)19-28(39)27(18-24-14-10-8-11-15-24)36-31(40)29(20(2)3)33-22(5)37/h8,10-11,14-15,20-21,25-30,39H,7,9,12-13,16-19H2,1-6H3,(H,33,37)(H,34,38)(H,35,41)(H,36,40)/t21-,26+,27-,28-,29-,30-/m0/s1 |
| InChIKey | PYEMAXTWECMDFL-FEYZTCBASA-N |
| XLogP | 3.24 |
| TPSA | 136.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.79 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |