C11H15BN2O2 — CID 59815784
CID 59815784 (PubChem CID 59815784) has the molecular formula C11H15BN2O2 and a molecular weight of 218.07 g/mol.
| Compound Name | CID 59815784 |
|---|---|
| PubChem CID | 59815784 |
| Molecular Formula | C11H15BN2O2 |
| Molecular Weight | 218.07 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N[C@@H](Cc1ccccc1)[C@H](O)CN |
| InChI | InChI=1S/C11H15BN2O2/c12-11(16)14-9(10(15)7-13)6-8-4-2-1-3-5-8/h1-5,9-10,15H,6-7,13H2,(H,14,16)/t9-,10+/m0/s1 |
| InChIKey | WJNIAVJRXNIDDL-VHSXEESVSA-N |
| XLogP | -0.20 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.07 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|