C15H23BN2O2 — CID 89187834
CID 89187834 (PubChem CID 89187834) has the molecular formula C15H23BN2O2 and a molecular weight of 283.23 g/mol.
| Compound Name | CID 89187834 |
|---|---|
| PubChem CID | 89187834 |
| Molecular Formula | C15H23BN2O2 |
| Molecular Weight | 283.23 g/mol |
| Exact Mass | 283.24 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])NC[C@@H](O)[C@H](Cc1ccccc1)NC([B])=O |
| InChI | InChI=1S/C15H23BN2O2/c1-11(2)9-17-10-14(19)13(18-15(16)20)8-12-6-4-3-5-7-12/h3-7,11,13-14,17,19H,8-10H2,1-2H3,(H,18,20)/t13-,14+/m0/s1/i1D3,2D3,9D2,11D |
| InChIKey | YEYKXFWHAIBEIT-OGSLKFPBSA-N |
| XLogP | 1.08 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.23 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|