C13H19ClF3NO2S — CID 174529281
1-chloropentane;2,2,2-trifluoro-1-phenylethanesulfonamide (PubChem CID 174529281) has the molecular formula C13H19ClF3NO2S and a molecular weight of 345.81 g/mol. Its IUPAC name is 1-chloropentane;2,2,2-trifluoro-1-phenylethanesulfonamide.
| Compound Name | 1-chloropentane;2,2,2-trifluoro-1-phenylethanesulfonamide |
|---|---|
| PubChem CID | 174529281 |
| Molecular Formula | C13H19ClF3NO2S |
| Molecular Weight | 345.81 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 1-chloropentane;2,2,2-trifluoro-1-phenylethanesulfonamide |
| SMILES | CCCCCCl.NS(=O)(=O)C(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C8H8F3NO2S.C5H11Cl/c9-8(10,11)7(15(12,13)14)6-4-2-1-3-5-6;1-2-3-4-5-6/h1-5,7H,(H2,12,13,14);2-5H2,1H3 |
| InChIKey | IEAOVXHEEJBEHP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.81 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|