About 1-chloropentane;phenylmethanediamine
1-chloropentane;phenylmethanediamine (PubChem CID 174896125) has the molecular formula C12H21ClN2
and a molecular weight of 228.77 g/mol. Its IUPAC name is 1-chloropentane;phenylmethanediamine.
Molecular Properties
| Compound Name | 1-chloropentane;phenylmethanediamine |
| PubChem CID | 174896125 |
| Molecular Formula | C12H21ClN2 |
| Molecular Weight | 228.77 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 1-chloropentane;phenylmethanediamine |
| SMILES | CCCCCCl.NC(N)c1ccccc1 |
| InChI | InChI=1S/C7H10N2.C5H11Cl/c8-7(9)6-4-2-1-3-5-6;1-2-3-4-5-6/h1-5,7H,8-9H2;2-5H2,1H3 |
| InChIKey | UKKSEUAHGYCFSF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.77 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-chloropentane;phenylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloropentane;phenylmethanediamine?
The IUPAC name of 1-chloropentane;phenylmethanediamine (CID 174896125) is 1-chloropentane;phenylmethanediamine.
What is the SMILES notation for 1-chloropentane;phenylmethanediamine?
The canonical SMILES for 1-chloropentane;phenylmethanediamine is CCCCCCl.NC(N)c1ccccc1.
What is the InChIKey of 1-chloropentane;phenylmethanediamine?
The InChIKey is UKKSEUAHGYCFSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2.C5H11Cl/c8-7(9)6-4-2-1-3-5-6;1-2-3-4-5-6/h1-5,7H,8-9H2;2-5H2,1H3.
What are the key properties of 1-chloropentane;phenylmethanediamine?
1-chloropentane;phenylmethanediamine has a molecular weight of 228.77 g/mol, XLogP of 3.02, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloropentane;phenylmethanediamine is sourced from PubChem (CID 174896125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).