About 1-chloropentane;N-[2-(trifluoromethyl)phenyl]methanesulfonamide
1-chloropentane;N-[2-(trifluoromethyl)phenyl]methanesulfonamide (PubChem CID 174529363) has the molecular formula C13H19ClF3NO2S
and a molecular weight of 345.81 g/mol. Its IUPAC name is 1-chloropentane;N-[2-(trifluoromethyl)phenyl]methanesulfonamide.
Molecular Properties
| Compound Name | 1-chloropentane;N-[2-(trifluoromethyl)phenyl]methanesulfonamide |
| PubChem CID | 174529363 |
| Molecular Formula | C13H19ClF3NO2S |
| Molecular Weight | 345.81 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 1-chloropentane;N-[2-(trifluoromethyl)phenyl]methanesulfonamide |
| SMILES | CCCCCCl.CS(=O)(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C8H8F3NO2S.C5H11Cl/c1-15(13,14)12-7-5-3-2-4-6(7)8(9,10)11;1-2-3-4-5-6/h2-5,12H,1H3;2-5H2,1H3 |
| InChIKey | MEQIEQSKZQFLQW-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.81 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloropentane;N-[2-(trifluoromethyl)phenyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloropentane;N-[2-(trifluoromethyl)phenyl]methanesulfonamide?
The IUPAC name of 1-chloropentane;N-[2-(trifluoromethyl)phenyl]methanesulfonamide (CID 174529363) is 1-chloropentane;N-[2-(trifluoromethyl)phenyl]methanesulfonamide.
What is the SMILES notation for 1-chloropentane;N-[2-(trifluoromethyl)phenyl]methanesulfonamide?
The canonical SMILES for 1-chloropentane;N-[2-(trifluoromethyl)phenyl]methanesulfonamide is CCCCCCl.CS(=O)(=O)Nc1ccccc1C(F)(F)F.
What is the InChIKey of 1-chloropentane;N-[2-(trifluoromethyl)phenyl]methanesulfonamide?
The InChIKey is MEQIEQSKZQFLQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F3NO2S.C5H11Cl/c1-15(13,14)12-7-5-3-2-4-6(7)8(9,10)11;1-2-3-4-5-6/h2-5,12H,1H3;2-5H2,1H3.
What are the key properties of 1-chloropentane;N-[2-(trifluoromethyl)phenyl]methanesulfonamide?
1-chloropentane;N-[2-(trifluoromethyl)phenyl]methanesulfonamide has a molecular weight of 345.81 g/mol, XLogP of 4.49, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloropentane;N-[2-(trifluoromethyl)phenyl]methanesulfonamide is sourced from PubChem (CID 174529363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).