C14H19ClF3N — CID 114149158
N-(5-chloro-2,2-dimethylpentyl)-2-(trifluoromethyl)aniline (PubChem CID 114149158) has the molecular formula C14H19ClF3N and a molecular weight of 293.76 g/mol. Its IUPAC name is N-(5-chloro-2,2-dimethylpentyl)-2-(trifluoromethyl)aniline.
| Compound Name | N-(5-chloro-2,2-dimethylpentyl)-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 114149158 |
| Molecular Formula | C14H19ClF3N |
| Molecular Weight | 293.76 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N-(5-chloro-2,2-dimethylpentyl)-2-(trifluoromethyl)aniline |
| SMILES | CC(C)(CCCCl)CNc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H19ClF3N/c1-13(2,8-5-9-15)10-19-12-7-4-3-6-11(12)14(16,17)18/h3-4,6-7,19H,5,8-10H2,1-2H3 |
| InChIKey | VPYRZCYRVOAYEW-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.76 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|