C16H21ClN2 — CID 106142336
N-(5-chloro-2,2-dimethylpentyl)quinolin-4-amine (PubChem CID 106142336) has the molecular formula C16H21ClN2 and a molecular weight of 276.81 g/mol. Its IUPAC name is N-(5-chloro-2,2-dimethylpentyl)quinolin-4-amine.
| Compound Name | N-(5-chloro-2,2-dimethylpentyl)quinolin-4-amine |
|---|---|
| PubChem CID | 106142336 |
| Molecular Formula | C16H21ClN2 |
| Molecular Weight | 276.81 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | N-(5-chloro-2,2-dimethylpentyl)quinolin-4-amine |
| SMILES | CC(C)(CCCCl)CNc1ccnc2ccccc12 |
| InChI | InChI=1S/C16H21ClN2/c1-16(2,9-5-10-17)12-19-15-8-11-18-14-7-4-3-6-13(14)15/h3-4,6-8,11H,5,9-10,12H2,1-2H3,(H,18,19) |
| InChIKey | RYIZPXANDNPBJU-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.81 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|