C11H14F3NO2S — CID 114827711
1,1,1-trifluoro-4-phenylpentane-2-sulfonamide (PubChem CID 114827711) has the molecular formula C11H14F3NO2S and a molecular weight of 281.30 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-phenylpentane-2-sulfonamide.
| Compound Name | 1,1,1-trifluoro-4-phenylpentane-2-sulfonamide |
|---|---|
| PubChem CID | 114827711 |
| Molecular Formula | C11H14F3NO2S |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 1,1,1-trifluoro-4-phenylpentane-2-sulfonamide |
| SMILES | CC(CC(C(F)(F)F)S(N)(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C11H14F3NO2S/c1-8(9-5-3-2-4-6-9)7-10(11(12,13)14)18(15,16)17/h2-6,8,10H,7H2,1H3,(H2,15,16,17) |
| InChIKey | TYUHRTNZXZLHCU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |