C6H12F3NO2S — CID 114827666
1,1,1-trifluoro-4-methylpentane-2-sulfonamide (PubChem CID 114827666) has the molecular formula C6H12F3NO2S and a molecular weight of 219.23 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-methylpentane-2-sulfonamide.
| Compound Name | 1,1,1-trifluoro-4-methylpentane-2-sulfonamide |
|---|---|
| PubChem CID | 114827666 |
| Molecular Formula | C6H12F3NO2S |
| Molecular Weight | 219.23 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 1,1,1-trifluoro-4-methylpentane-2-sulfonamide |
| SMILES | CC(C)CC(C(F)(F)F)S(N)(=O)=O |
| InChI | InChI=1S/C6H12F3NO2S/c1-4(2)3-5(6(7,8)9)13(10,11)12/h4-5H,3H2,1-2H3,(H2,10,11,12) |
| InChIKey | AZISQDHUFAHCFQ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.23 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |