C8H17F2NO4S2 — CID 135209172
N-(1,1-difluoroethylsulfonyl)-4-methylpentane-1-sulfonamide (PubChem CID 135209172) has the molecular formula C8H17F2NO4S2 and a molecular weight of 293.36 g/mol. Its IUPAC name is N-(1,1-difluoroethylsulfonyl)-4-methylpentane-1-sulfonamide.
| Compound Name | N-(1,1-difluoroethylsulfonyl)-4-methylpentane-1-sulfonamide |
|---|---|
| PubChem CID | 135209172 |
| Molecular Formula | C8H17F2NO4S2 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | N-(1,1-difluoroethylsulfonyl)-4-methylpentane-1-sulfonamide |
| SMILES | CC(C)CCCS(=O)(=O)NS(=O)(=O)C(C)(F)F |
| InChI | InChI=1S/C8H17F2NO4S2/c1-7(2)5-4-6-16(12,13)11-17(14,15)8(3,9)10/h7,11H,4-6H2,1-3H3 |
| InChIKey | GFUCORGOSAYYFO-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |