C9H17ClF3NO2S — CID 106135566
N-(4-chloropentyl)-4,4,4-trifluorobutane-1-sulfonamide (PubChem CID 106135566) has the molecular formula C9H17ClF3NO2S and a molecular weight of 295.75 g/mol. Its IUPAC name is N-(4-chloropentyl)-4,4,4-trifluorobutane-1-sulfonamide.
| Compound Name | N-(4-chloropentyl)-4,4,4-trifluorobutane-1-sulfonamide |
|---|---|
| PubChem CID | 106135566 |
| Molecular Formula | C9H17ClF3NO2S |
| Molecular Weight | 295.75 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | N-(4-chloropentyl)-4,4,4-trifluorobutane-1-sulfonamide |
| SMILES | CC(Cl)CCCNS(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C9H17ClF3NO2S/c1-8(10)4-2-6-14-17(15,16)7-3-5-9(11,12)13/h8,14H,2-7H2,1H3 |
| InChIKey | HXWNYYFVOPYGKT-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.75 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|