C11H22F3NO3S — CID 71905535
4,4,4-trifluoro-N-[3-(2-methylpropoxy)propyl]butane-1-sulfonamide (PubChem CID 71905535) has the molecular formula C11H22F3NO3S and a molecular weight of 305.36 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-[3-(2-methylpropoxy)propyl]butane-1-sulfonamide.
| Compound Name | 4,4,4-trifluoro-N-[3-(2-methylpropoxy)propyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 71905535 |
| Molecular Formula | C11H22F3NO3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 4,4,4-trifluoro-N-[3-(2-methylpropoxy)propyl]butane-1-sulfonamide |
| SMILES | CC(C)COCCCNS(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C11H22F3NO3S/c1-10(2)9-18-7-4-6-15-19(16,17)8-3-5-11(12,13)14/h10,15H,3-9H2,1-2H3 |
| InChIKey | KVDOMHHOVOHCNJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|