C8H16F3NO3S — CID 99802931
N-(3-ethoxypropyl)-3,3,3-trifluoropropane-1-sulfonamide (PubChem CID 99802931) has the molecular formula C8H16F3NO3S and a molecular weight of 263.28 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-3,3,3-trifluoropropane-1-sulfonamide.
| Compound Name | N-(3-ethoxypropyl)-3,3,3-trifluoropropane-1-sulfonamide |
|---|---|
| PubChem CID | 99802931 |
| Molecular Formula | C8H16F3NO3S |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | N-(3-ethoxypropyl)-3,3,3-trifluoropropane-1-sulfonamide |
| SMILES | CCOCCCNS(=O)(=O)CCC(F)(F)F |
| InChI | InChI=1S/C8H16F3NO3S/c1-2-15-6-3-5-12-16(13,14)7-4-8(9,10)11/h12H,2-7H2,1H3 |
| InChIKey | RHFTWFPVNSYJHU-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|