C11H26N2O3S — CID 114171594
N-[3-(2-aminoethoxy)propyl]-3,3-dimethylbutane-1-sulfonamide (PubChem CID 114171594) has the molecular formula C11H26N2O3S and a molecular weight of 266.41 g/mol. Its IUPAC name is N-[3-(2-aminoethoxy)propyl]-3,3-dimethylbutane-1-sulfonamide.
| Compound Name | N-[3-(2-aminoethoxy)propyl]-3,3-dimethylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 114171594 |
| Molecular Formula | C11H26N2O3S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | N-[3-(2-aminoethoxy)propyl]-3,3-dimethylbutane-1-sulfonamide |
| SMILES | CC(C)(C)CCS(=O)(=O)NCCCOCCN |
| InChI | InChI=1S/C11H26N2O3S/c1-11(2,3)5-10-17(14,15)13-7-4-8-16-9-6-12/h13H,4-10,12H2,1-3H3 |
| InChIKey | RZMPJZZCFSEMFZ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|