C11H26N2O2S — CID 103520785
N-(5-aminopentyl)-3,3-dimethylbutane-1-sulfonamide (PubChem CID 103520785) has the molecular formula C11H26N2O2S and a molecular weight of 250.41 g/mol. Its IUPAC name is N-(5-aminopentyl)-3,3-dimethylbutane-1-sulfonamide.
| Compound Name | N-(5-aminopentyl)-3,3-dimethylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 103520785 |
| Molecular Formula | C11H26N2O2S |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | N-(5-aminopentyl)-3,3-dimethylbutane-1-sulfonamide |
| SMILES | CC(C)(C)CCS(=O)(=O)NCCCCCN |
| InChI | InChI=1S/C11H26N2O2S/c1-11(2,3)7-10-16(14,15)13-9-6-4-5-8-12/h13H,4-10,12H2,1-3H3 |
| InChIKey | GIRXYZOBHHAGNE-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|