C10H22BrNO3S — CID 103521791
N-[2-(2-bromoethoxy)ethyl]-3,3-dimethylbutane-1-sulfonamide (PubChem CID 103521791) has the molecular formula C10H22BrNO3S and a molecular weight of 316.26 g/mol. Its IUPAC name is N-[2-(2-bromoethoxy)ethyl]-3,3-dimethylbutane-1-sulfonamide.
| Compound Name | N-[2-(2-bromoethoxy)ethyl]-3,3-dimethylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 103521791 |
| Molecular Formula | C10H22BrNO3S |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | N-[2-(2-bromoethoxy)ethyl]-3,3-dimethylbutane-1-sulfonamide |
| SMILES | CC(C)(C)CCS(=O)(=O)NCCOCCBr |
| InChI | InChI=1S/C10H22BrNO3S/c1-10(2,3)4-9-16(13,14)12-6-8-15-7-5-11/h12H,4-9H2,1-3H3 |
| InChIKey | PZZFYNVSYWRHAH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|