C10H22BrNO2S — CID 103521803
N-(1-bromo-2-methylpropan-2-yl)-3,3-dimethylbutane-1-sulfonamide (PubChem CID 103521803) has the molecular formula C10H22BrNO2S and a molecular weight of 300.26 g/mol. Its IUPAC name is N-(1-bromo-2-methylpropan-2-yl)-3,3-dimethylbutane-1-sulfonamide.
| Compound Name | N-(1-bromo-2-methylpropan-2-yl)-3,3-dimethylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 103521803 |
| Molecular Formula | C10H22BrNO2S |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | N-(1-bromo-2-methylpropan-2-yl)-3,3-dimethylbutane-1-sulfonamide |
| SMILES | CC(C)(C)CCS(=O)(=O)NC(C)(C)CBr |
| InChI | InChI=1S/C10H22BrNO2S/c1-9(2,3)6-7-15(13,14)12-10(4,5)8-11/h12H,6-8H2,1-5H3 |
| InChIKey | PSEUXLUWQBLJCA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|